Login or Sign Up

Ask a New Question

Destiny

Questions and answers by visitors named Destiny

Questions (224)

Suppose you have a mean standardized score of 1500 points with a standard deviation of 150 points. This data is normally
1. 4 answers
2. 2,969 views
One positive aspect of the potential use of methane hydrate as a fuel is thatA.it exists in a pure form ready for use B.there is
1. 3 answers
2. 1,027 views
Which of the follow is a form of cyber bullying?
1. 3 answers
2. 39 views
use fraction bars to help:a) 11/12=w+y b)3/8=3/6-k c)1/4=n-7/12 d) how many 1/12's are in 1 1/4? help! im sooooooo.....
1. 1 answer
2. 583 views
Can you please help me make new words from the following: views, player, remote, exits, lacees and newer. I had fifty and just
1. 1 answer
2. 458 views
explain divisabilaty
1. 1 answer
2. 317 views
I was given a world map (flat, 1 dimensional) and instructed to identify locations of where different fossils were located. The
1. 4 answers
2. 1,387 views
Simplify 3(sqrt{2xy}) - 2(sqrt{50xy})
1. 1 answer
2. 311 views
Complete the statementa) (5x - y) = (5 -1) (x) (2x + y) = ( ) (y)
1. 1 answer
2. 276 views
I am super confused with permutations and combinations. I just don't see when you are supposed to use each one, and when you
1. 7 answers
2. 757 views
what is a regoin
1. 4 answers
2. 640 views
How would i compare todays time with the Roman times?
1. 3 answers
2. 341 views
HELP!!!!!!!!!!!!!write equation of a polynomial function with the given characteristics. Leading coefficient is 1 or -1 crosses
1. 4 answers
2. 3,271 views
Could you translate this in french for me because I don't want to have anything wrong with mine.I appreciate my dad for doing
1. 3 answers
2. 379 views
I'll post my finished work when you answer me that you are still online
1. 4 answers
2. 342 views
Bonjour!! I posted a question a few days ago sorry I didn't answer you back but now I have the chance. Could you please check
1. 2 answers
2. 510 views
Solve the simultaneous equations:3x-2y=19 2x+3y=4 Do i create a 3rd eq like this? 6x-4y=38 and where do i go from here?
1. 3 answers
2. 561 views
Riddle: I do not have shape or volume. You cannot see me, but I fill any container in which I am placed. I have weight, but you
1. 7 answers
2. 1,017 views
important physical and man-made features of the united states including: Coastal Plains, Great Plains, Continental Divide, The
1. 2 answers
2. 501 views
The quotient of julians age and 3 is 4 what is julians age in years
1. 4 answers
2. 172 views
Ok, i need to know a equivalent decimal and a percent for the fraction 10/17.Thanks, Destiny
1. 7 answers
2. 396 views
Allie was setting up a fish tank in her room. She needed to find a tank that would fit on her table. What metric unit should she
1. 3 answers
2. 508 views
How does the Diethylacetal impurity arise in fermentation?
1. 1 answer
2. 983 views
Calculate how many milliliters of carbon dioxide would be produced theoretically from 2.0g of sucrose at 25 deg Cel and 1 atm
1. 7 answers
2. 2,291 views
at the animal shelter , one third ofthe animals are dogs , 1/6 are cats,and 19 arethe other animals.how many animals are at the
1. 3 answers
2. 541 views
List at least two pros and two cons for each of the given patient and caregiver roles by filling in the appropriate spaces in
1. 1 answer
2. 418 views
what are the answers to the 5th grade unit 1 test harcourt
1. 13 answers
2. 114 views
President Bush has stated that if any non-democratic country's people seek freedom, America will stand with them. Freedom and
1. 1 answer
2. 425 views
What is the rule for this input output tabel?Input Output 5 12 8 24 11 36 14 48
1. 1 answer
2. 382 views
Hey, Im doing a short essay and my teacher wants me to use high level words, so not simple ones. Is there a good site which I
1. 6 answers
2. 481 views
Two rectangular boxes are similar. One box has the length of 24 inches. and a width of 9 inches. If the other box has a length
1. 3 answers
2. 466 views
1.At what age does exercise begin to result in strength in boys and girls?a)between ages 1 and 2 b)between ages 3 and 4
1. 4 answers
2. 469 views
Which statistical measure would you use if an outlier is present (mean, median, mode, or rang)? Explain.
1. 1 answer
2. 317 views
Blockbust video collected data to figure out how many movies they were renting per month. After 5 months, the store wanted to
1. 4 answers
2. 518 views
What is the area of a rhombus with a 60 degree angle and sides 5 cm long?
1. 2 answers
2. 506 views
write an expression that tells how to find the perimeter of a triangle with each side 2 inches long
1. 3 answers
2. 404 views
write an expression that tells how to find the perimeter of a triangle with each side 2 inches long
1. 1 answer
2. 382 views
List the types of potential segmenting dimensions, and explain which you would try to apply first, second, and third in a
1. 2 answers
2. 1,353 views
How many calories are absorbed by a copper spoon with a mass of 200 grams as it changes from 28°C to 33°C?A) 0.00027 B) 3 C)
1. 2 answers
2. 934 views
List and discuss the 4 P’s (marketing mix) The 4 P’s in the marketing mix consist of
1. 2 answers
2. 554 views
Discuss the universal functions of marketing and those functions that would apply to the products/services provided by a
1. 1 answer
2. 417 views
Read Chapter 21 and provide a succinct overview of the key components of a marketing plan.
1. 1 answer
2. 393 views
Discuss the dimensions for segmenting markets
1. 1 answer
2. 333 views
Explain the importance of an organized new-product development process and illustrate how it might b used for (a) a new hair
1. 2 answers
2. 533 views
Identify the strategy decisions a marketing manager must make in the Price area. Illustrate your answer for a local retailer.
1. 1 answer
2. 1,089 views
Discuss the type of media that might be most suitable for promoting (a) tomato soup, (b) greeting cards, (c) a business
1. 2 answers
2. 580 views
Identify the strategy decisions a marketing manager must make in the Price area. Illustrate your answer for a local retailer.
1. 2 answers
2. 1,097 views
The size of a certain cell is 2.5 × 10–9 m. Another cell is 1.5 × 103 times larger. How large is the larger cell in
1. 7 answers
2. 3,611 views
An automobile with an initial speed of 4.82 m/s accelerates uniformly at the rate of 2.2 m/s2. Find the displacement of the car
1. 2 answers
2. 684 views
1,Sovle using the substitution method. Show your work. If the system has no solution or an infinite number of solutions,state
1. 1 answer
2. 477 views
Sovle using the elimination method. Show your work. If the system has no solution or an infinite number of solutions, state this
1. 2 answers
2. 660 views
Use scientific to divde the following two numbers. Express the answer using scientific notation; retain at least three decimal
1. 1 answer
2. 430 views
Add polynomials0.15x^4 + 0.10x^3 - 0.01x^3 + 0.01x^2 + x 1.25x^4 + 0.11x^2 + 0.01 027x^3 + 0.99 -0.35x^4 + 15x^2 - 0.03 I don't
1. 2 answers
2. 1,216 views
If a jogger's velocity begins at 2 m/s and changes to 1.5 m/s uphill, how do you know that the hiker has a negative acceleration
1. 1 answer
2. 347 views
When a mixture of 10.0 g of acetylene and 10.0 g of oxygen is ignited, a complete combustion of the reactants takes place. What
1. 2 answers
2. 541 views
Tartaric acid has two acidic (ionizable) hydrogens. The acid is often present in wines and precipitates from solution as wine
1. 1 answer
2. 1,293 views
the gaseous product of a reaction is collected in a 25.0L container at 27c. the pressure in the container is 300.0 kpa and the
1. 3 answers
2. 1,431 views
if you are riding on a ferris wheel that is 60 ft tall and it takes you 5 minutes to make 1 revolution, what is your linear
1. 2 answers
2. 577 views
Whats is a legal ststem based on custom and court descicons?
1. 1 answer
2. 330 views
statistical midels predict that price p (in dollars) of a new smartphone will change according to the function p= 900-4t^2,
1. 1 answer
2. 615 views
Marie measured angle KLM.She said it was 60 degrees.What mistake did she make?
1. 3 answers
2. 408 views
what is the solution of this inequality?: x+3/x^2-5x+4>_0?
1. 1 answer
2. 261 views
what is the solution of this inequality?: x+3/x^2-5x+4>_0?
1. 1 answer
2. 256 views
find the intervals on which the function is increasing or decreasing and find any relative minima or maxima.f(x)=0.2x^3-0.2x^2-5
1. 2 answers
2. 590 views
What do you hope to accomplish COM 155?
1. 1 answer
2. 328 views
Write a 150- to 200-word paragraph to explain how purpose, audience, tone, and content would impact the following topic: What do
1. 3 answers
2. 926 views
plz help with equation 5x-9y=11=3x+7y=19
1. 1 answer
2. 449 views
5x-9y=113x+7y=19.......plz help serious..........
1. 3 answers
2. 350 views
All are True/False1. After WWI, Ho Chi Minh tried to get the U.S. to support independence for Vietnam. 2. Ho Chi Minh's forces
1. 3 answers
2. 558 views
I need to observe and identify variables and I'm in 6th grade!!! Help, this work is killing me....It's scenario 1-4 and I have
1. 3 answers
2. 392 views
1) x-4-92) 15-y-7 3) 31-35-y
1. 1 answer
2. 180 views
Find the change in temperature or elevation.1) From -16 degrees C to 23 degrees C 2) From -47 degrees C to -38 degrees C 3) From
1. 4 answers
2. 1,997 views
Hi,I am doing a paper for school and I need to know what are some Negative and Positive Impacts of the Telegraph? I know some
1. 4 answers
2. 430 views
1.What are the equivalent fraction and decimal for thirty-three and one-third%? (1 point) one over thirty-three and 0.3 one over
1. 25 answers
2. 7,334 views
What are Two examples of Internet Vandalism
1. 3 answers
2. 321 views
In the Earth's Sourthern Hemisphere, what season begins in March?Spring Summer Fall Winter
1. 5 answers
2. 258 views
Find the interest earned on each account.$970 at 4 1/2% simple interest for 2 years. I don't know if I solved the problem
1. 6 answers
2. 891 views
Find the percent of markup. Round to the nearest whole percent.6. Store's Cost: $136.50 Selling Price: $184.70 (1 point) 48% 26%
1. 6 answers
2. 977 views
Answer the following question in your discussion group: Sometimes people say “Give 110% of your effort.” Is it possible to
1. 5 answers
2. 852 views
I am writing a persuasive essay and I need some tips on making it persuasive. It is turning out to be just an essay, not a
1. 2 answers
2. 719 views
How is an inequality different from an equation? Give a real-world scenario in which you would write an inequality rather than
1. 3 answers
2. 602 views
How is an inequality different from an equation? Give a real-world scenario in which you would write an inequality rather than
1. 3 answers
2. 529 views
How is an inequality different from an equation? Give a real-world scenario in which you would write an inequality rather than
1. 16 answers
2. 5,063 views
How is an inequality different from an equation? Give a real-world scenario in which you would write an inequality rather than
1. 4 answers
2. 776 views
Analyze the causes of anorexia in hospitalized patients.Provide two patient scenarios that commonly result in decreased food
1. 1 answer
2. 410 views
1) Find the surface area for a sphere with a radius of 10 feet. Round to the nearest whole number.a. 1,256 ft2 b. 4,189 ft2 c.
1. 9 answers
2. 1,163 views
I REALLY NEED HELP PLEASE PLEASE HELP ME WITH THIS JUST CHECK IF THERE RIGHT IF NOT THEN GIVE ME THE RIGHT ANSWER PLEASE PLEASE
1. 6 answers
2. 1,418 views
How many grams of CaCl2 are required to prepare 2.00 liters of 7.00 M CaCl2?
1. 2 answers
2. 545 views
Marlon has 4 cards, jake has 4 cards, and Sam has 3 cards. Can u write a multiplication sentence to find how many cards they
1. 4 answers
2. 1,636 views
What is y if 6y+1=21y+13
1. 1 answer
2. 445 views
Is carbon phosphate an ionic, polar covalent, or non polar covalent bond?
1. 2 answers
2. 531 views
1. What act did Congress pass in order to relocate Native Americans?a.) Naturalization Act b.) Alien Act c.) Relocation Act d.)
1. 20 answers
2. 1,224 views
Which verb correctly completes the below sentence?The collection written by several of my favorite authors _____ research in the
1. 10 answers
2. 1,095 views
The article is at the bottom for this question:Skim the article “Cruise Control” to find the name of the bumper sticker
1. 3 answers
2. 489 views
Bubble wrap sells in sheets, and each sheet has 1 million individual spherical bubbles, each with a diameter of 0.01 m. What is
1. 3 answers
2. 1,146 views
a line segment has end point P(3,6) and Q(12,18) and is dilated so that's its new endpoints are Q' (8,12). What is the scale
1. 4 answers
2. 1,238 views
Give reasons why the reaction between benzoylchloride and methanol do not attack carbon from the ring
1. 2 answers
2. 502 views
In a large lot of electric light bulbs,5% of the bulbs are defective.calculate the probability that a random sample of 20 will
1. 2 answers
2. 538 views
Explain why this reaction is not feasible:CH3CHO^-Na^+ + CH3C(CH3)2Cl=CH3CH2O(CH3)2OCH3. ;->Becos of ion charge of Oxygen and Na
1. 1 answer
2. 406 views
Two cars traveled equal distances in different amounts of time. Car A traveled the distance in 2.4 h, and Car B traveled the
1. 4 answers
2. 1,410 views

Pages

1
2
3

Questions LLC

Use AI to answer your questions.

Ask a New Question

Company

About Us
Careers
Contact Us
Privacy Policy
Terms of Use

Questions

Archives
Categories
Newest
Random
Search

Trending

Now
Today
Week
Month
Year

Social

Facebook
Instagram
LinkedIn
YouTube
X

© 2024 Questions LLC. All rights reserved.