Login or Sign Up

Ask a New Question

Lillian

Questions and answers by visitors named Lillian

Questions (63)

1. Carey has a bag of marbles. There are 4 red marbles, 5 blue marbles, and 1 green marble. She conducted an experiment in which
1. 13 answers
2. 3,279 views
Approximate e^-0.6 to 3 decimal places.I am not sure how to approach this without a calculator. I don't think we are allowed to
1. 5 answers
2. 4,153 views
Does anyone know what advantage there is to using hot water to make ice cubes?Validated tests indicate it is faster to freeze
1. 2 answers
2. 586 views
why does a can of soda explode in a hot car?As the temperature rises, the gas (carbon dioxide that make the fizzle in soda
1. 1 answer
2. 678 views
What is the name for the condition when a person feels dizzy and passes out at the sight of blood?Thank you for using the Jiskha
1. 1 answer
2. 922 views
It decreases?If the air pressure increased, wouldn't that make the diver go down? What happens when you press on the pressure
1. 1 answer
2. 864 views
write (27a^-3)^(-2/3) in simplest form.solve log(6x+11)=2 please and thanks I need to see your work on the first. On the second,
1. 1 answer
2. 455 views
write (27a^-3)^(-2/3) in simplest form.solve log(6x+11)=2 please and thanks I am not going to give you the answers. I will be
1. 1 answer
2. 518 views
Can someone please help me with these problems?Write (27a^-3)^-2/3 in simplest form. Solve log(6x+11)=2. thanks Let me see your
1. 1 answer
2. 802 views
Hi. I have to pick a book by Edward Abbey to read. Then I have to write a paper that covers:-what Ed was trying to accomplish
1. 2 answers
2. 525 views
Hi. I was wondering if someone could help me grasp a concept. The concept is that soon the world will run out of natural
1. 1 answer
2. 516 views
Can someone suggest any poems that somehow encapsulates the sentiments of Huckleberry Finn" by Mark Twain?I know of none, but
1. 1 answer
2. 458 views
Could someone explain the concept of judicial review and its impact on the balance of power in the United States Government?Judi
1. 1 answer
2. 937 views
When and where did people still believe the world is flat?I thought they did in Columbus's time, but I guess that was a myth?
1. 7 answers
2. 749 views
Is there a model to measure the letters/fonts so that each letter is the same size? Or, do I need to measure each letter
1. 3 answers
2. 476 views
I need some explanation about fonts and how to use them. Need to complete an assignement requesting that fonts are used for
1. 1 answer
2. 389 views
A car is driven at 80km/h on a horizontal road. If the car is now driven up 10m high rise, what speed would it have at the top
1. 2 answers
2. 543 views
Medallion Cooling Systems, Inc., has total assets of $10,000,000, EBIT of $2,000,000, and preferred dividends of $200,000 and is
1. 1 answer
2. 1,179 views
for the reaction: c3h8+5o2=3co2 +4h2o how many moles of o2 will be produced in the complete combustion of 0.75 moles of c3h8?
1. 2 answers
2. 670 views
for the reaction: c3h8+5o2=3co2 +4h2o how many moles of o2 will be produced in the complete combustion of 0.75 moles of c3h8?I
1. 4 answers
2. 3,205 views
For the reaction C3H8+5CO2=3CO2+4H2OHow many grams of O2 react with 8.80grams of C3H8? I think the ans is 32.0gO2
1. 2 answers
2. 874 views
For the reaction C3H8+5CO2=3CO2+4H2OHow many moles of c3h8 are needed to make 3.6 grams of c3h8? I think the ans is
1. 4 answers
2. 1,251 views
For the reaction C3H8+5CO2=3CO2+4H2OHow many grams of co2 will be produced by buring 0.15 moles of c3h8?i thoink the ans is
1. 1 answer
2. 460 views
For the reation: C3H8+5 02 =3 CO2+4 H2OHow many moles of C3H8 are needed to make 3.60 grams of H2O? I think the ans is
1. 1 answer
2. 411 views
For the reation: C3H8+5 02 =3 CO2+4 H2OHow many moles of C3H8 are needed to make 3.60 grams of H2O? I think the ans is
1. 3 answers
2. 537 views
For the reation: C3H8+5 02 =3 CO2+4 H2OHow many moles of C3H8 are needed to make 3.60 grams of H2O? I think the ans is 0.05
1. 4 answers
2. 629 views
for thr reation: 2AlCl3 + 3H2SO4= Al2(SO4)3 + 6 HClHow many grams of H2SO4 are needed to produce 27.0 grams of Al2(SO4)3
1. 5 answers
2. 802 views
According to Kleiber's Law, the metabolic rate P (in kilocalories per day) and body mass m (in kilograms) of an animal are
1. 4 answers
2. 3,051 views
HelloI am doing a project about the spanish colonial Floridians Time during the time when there was the 13 original colonies.For
1. 4 answers
2. 449 views
A steamer goes 91 mi up a river in 6.5 h. The return trip is scheduled for 3.5 h. What is the rate of the water?
1. 1 answer
2. 288 views
Pedro has two options: he can enter raffle number 1, OR raffle number 2 along with raffle number 3. If Pedro chooses to enter
1. 1 answer
2. 881 views
if you have a jar filled with candy and every time you take one candy out you put the wrapper back into the jar. the wrapper
1. 1 answer
2. 475 views
Find the theoretical and actual yield of 25.0g Pb(NO3)2+15.0g2NaI=PbI2+2Na(NO2)
1. 2 answers
2. 473 views
Hello, I had to answer to some questions on the this paragraph of 'The Cask of Amontillado' by Edgar Allen Poe.The paragraph:
1. 2 answers
2. 835 views
The 9th term of an arithmetic sequence is 12 and the 17th term is 28, find the 4th term of the arithmetic sequences
1. 3 answers
2. 980 views
The Genetic information Nondiscrimination Act applies to which insurer
1. 1 answer
2. 480 views
Alicia wants to build a block pyramid similar to the one shown. block pyramid the top level will always have 2 blocks. Alicia
1. 2 answers
2. 1,046 views
Multiply and simplify. Assume any factors you cancel are not zero.8/(15x+24y) times (5x+8y)/10 = ?? I multiplied straight across
1. 3 answers
2. 686 views
Multiply and simplify. Assume any factors you cancel are not zero.8/(15x+24y) times (5x+8y)/10 = ?? I multiplied straight across
1. 2 answers
2. 614 views
Evaluate the following expression:sin(cos^-1(12/13)) tan(sin^-1(3/5)) I do not know what the inverse values would be...how would
1. 1 answer
2. 467 views
Perform the indicated operation. Simplify the result, if possible.11 - \frac{5}{4x-5} would you multiply the denominator to both
1. 2 answers
2. 640 views
Find the domain and range for y=x^2+9.Wouldn't the domain and range just be all real numbers since nothing else is really given
1. 2 answers
2. 535 views
How many possible lunch combinations can I choose from with 12 meats, 20 side items, 7desserts, and 8 drinks?
1. 3 answers
2. 408 views
In a suburb of Houston, housing costs have been increasing at 5.2% per a year compounded annually for the past 8 years. A house
1. 1 answer
2. 678 views
A newly couple has $15,000 toward the purchase of a house. For the type and size of house the couple is interested in buying, an
1. 3 answers
2. 1,156 views
Traditional healers should not allowed to prescribe medicine in hospitals or clinics
1. 1 answer
2. 429 views
6. Describe the female reproductive system in a human.7. Describe the male reproductive system in a human. My question was
1. 4 answers
2. 1,000 views
1. Flavia tossed two six-sided number cubes and added the numbers together. Which outcomes have a probability of1/12? Select two
1. 18 answers
2. 3,827 views
Compare and contrast the key features of Sunni and Shia Islam, and explain how differences between these two sects have
1. 2 answers
2. 2,607 views
Read the following paragraph and then answer the question that follows:Video games can kill! That is what many who support
1. 2 answers
2. 960 views
Write the composite function in the form f(g(x)). [Identify the inner functionu = g(x) and the outer function y = f(u).] (Use
1. 6 answers
2. 13,949 views
Lexi has 2 cans of tennis balls. There are 3 tennis balls in each can. She buys 2 more cans. How many tennis balls does she now
1. 5 answers
2. 890 views
There are 6 teams in the basketball league. Each team has 8 players. How many players are there? Please make sure that the
1. 3 answers
2. 720 views
Lynn has 4 stacks of quarters. There are 8 quarters in each stack. How many quarters does Lynn have? Can you please make sure
1. 1 answer
2. 437 views
Jenna says that no row or column contains products with only odd numbers. Do you agree? Explain. Can you guys please make sure
1. 5 answers
2. 273 views
Can you guys answer this question in the book Sasquatch Escape chapter 9. What do you think will happen next with Ben, Pearl and
1. 1 answer
2. 309 views
A scarf is made of 65% cotton. If the scarf weighs 18 ounces, then how much cotton is the scarf?
1. 1 answer
2. 260 views
Out of 350 students, 315 went on the field class trip. What percent of students did NOT go on the field trip?
1. 3 answers
2. 813 views
Line segment JM has endpoints with coordinates -2 and 14 on a number line. Points K and L are on segment JM. K has a coordinate
1. 4 answers
2. 1,174 views
Read the passage below and answer the question.A vague chill had descended on him and his head had seemed to swell, like a
1. 2 answers
2. 530 views
Amir is trying to determine the author's purpose as he reads the article "The Great Molasses Flood" for history class. He
1. 17 answers
2. 1,346 views
The total energy of motion in the molecules of a substance is called nuclear energy. true or false?
1. 1 answer
2. 398 views
What is the value of x in Na2CO3XH2O
1. 1 answer
2. 78 views

Questions LLC

Use AI to answer your questions.

Ask a New Question

Company

About Us
Careers
Contact Us
Privacy Policy
Terms of Use

Questions

Archives
Categories
Newest
Random
Search

Trending

Now
Today
Week
Month
Year

Social

Facebook
Instagram
LinkedIn
YouTube
X

© 2024 Questions LLC. All rights reserved.