Login or Sign Up

Ask a New Question

ivy

Questions and answers by visitors named ivy

Questions (61)

a toy balloon is in the shape of a sphere. it is being inflated at the rate of 20 in^3 / min. at the moment that the sphere has
1. 4 answers
2. 1,571 views
Which quantity is proportional to 65⁄5?
1. 4 answers
2. 3,144 views
give a scientific explanation for the following observations. Use equations or diagrams if they are relevant.A. it takes longer
1. 4 answers
2. 813 views
Give a scientific explanation for the following observations. Use equations or diagrams if they are relevant.A. burning coal
1. 4 answers
2. 577 views
Give a scientific explanation for the following observations: Perspiring is a mechanism for cooling the body-is it because when
1. 4 answers
2. 831 views
one of the problem of liberty is that one person's liberty sometimes conflicts with another's liberty and one must take
1. 3 answers
2. 458 views
Does a president’s personality have much to do with the selection of staff organization (circular or pyramid)?
1. 1 answer
2. 302 views
extend the following sentece to illustrate the recursive feature of language(syntax)what is there?
1. 3 answers
2. 303 views
given that a+b/5 = b+c/6 = c+a/7 = k,find the ratio a:b:c.
1. 3 answers
2. 351 views
what is the minimum length of the mirror needed to view the whole body at any distance?
1. 1 answer
2. 332 views
Convert 0.925 g/l to mg/100ml?
1. 1 answer
2. 301 views
6.375 g/dl convert to g/100ml?
1. 1 answer
2. 295 views
find p/q if (2q^2-pq):(q^2-pq) = 2:3.
1. 2 answers
2. 799 views
Is the hormone protein,steroid or glycoprotein?1. Follicle-stimulating hormone 2. Cortisol 3. Antidiuretic hormone 4.
1. 2 answers
2. 604 views
Compare and Contrast the following thyroid disorders?1. IODINE DEFICIENCY a. Does it cause goiter (yes or no) b. Is the
1. 2 answers
2. 543 views
Which might, in theory, be used to combat osteoporosis? Parathyroid or Calcitonin?
1. 1 answer
2. 351 views
How is this hormones regulated: hypothlamus/pituitary axis, nervous system,feedback inhibition indicate which?1. Follicle
1. 2 answers
2. 542 views
Where is Parathyroid hormone and Calcitonin each synthesize, and by what specific type of cell?
1. 1 answer
2. 287 views
what does skin have to do with bone formation?
1. 1 answer
2. 258 views
what causes calcium to be released in sliding filament action for muscle contraction?
1. 1 answer
2. 325 views
how do regions of the brain control motor neurons?
1. 1 answer
2. 356 views
How might the following affect blood volume (increase or decrease) (note: refer to physiology of kidney):High protein
1. 1 answer
2. 477 views
Suppose a salt and a glucose solution are separated by a membrane that is permeable to water but not to the solutes. The NaCl
1. 3 answers
2. 1,361 views
Before the invention of refrigerators, pioneers preserved meat by salting it. Explain how meat can be preserved by this
1. 1 answer
2. 831 views
Would you expect the muscle fibers of the tongue to be striated or smooth? What about the muscle of the diaphragm? Explain your
1. 2 answers
2. 884 views
Compare and Contrast the structure and function of the epithelium of the skin and the epithelium of the intestion
1. 1 answer
2. 437 views
Suppose you were to grind up and homogenate a pancreas. Do you think it would be possible to isolate insulin from this
1. 1 answer
2. 638 views
Indicate whether the following would increase or decrease during exercise.?1.activity of the sympathetic nervous system 2.urine
1. 2 answers
2. 587 views
Indicate the site of the following activity in the digestive system (mouth, esophagus, stomach, small intestine, large
1. 2 answers
2. 709 views
Clotting disorders are common, complex and affected by a variety of medications or mechanisms. Match the mechanism to the
1. 1 answer
2. 441 views
For discussion of endocrine disorders1.Diabetes insipidus Hormone affected? Too much or too little? 2.Graves’ disease Hormone
1. 2 answers
2. 578 views
Match the hormone or regulatory mechanism to digestive function.?a. Enterokinase b. gastrin c. intestinal cells of Cajal d.
1. 2 answers
2. 594 views
Indicate the effect of the hormone on the response (increase, decrease, no effect)?1.__________________ effect of secretion of
1. 2 answers
2. 513 views
in triangle fgh,angle f=32, angle g= 100. find angle h
1. 3 answers
2. 310 views
An iceberg breaks off from the Antarctic continent and floats due north at constant velocity/ It's latitude south decreases by 1
1. 2 answers
2. 879 views
A train braking with constant deceleration covers 1km in 20s, and a second kilometre in 30s. Find the Deceleration. Wgat further
1. 3 answers
2. 726 views
why does the melted wax turns solid when dropped on water ?
1. 4 answers
2. 1,065 views
examples of folk narratives with sources
1. 1 answer
2. 441 views
. Explain the following unexpected result:$ whereis date date: /bin/date ... $ echo $PATH .:/usr/local/bin:/usr/bin:/bin $ cat >
1. 4 answers
2. 4,274 views
which procedure is a chemical change that may be used to break down a compound?
1. 1 answer
2. 296 views
What is the volume of a piece of iron (ñ = 4.4 g/cm3) that has a mass of 0.65 kg?
1. 1 answer
2. 344 views
What is the volume of a piece of iron (ñ = 4.4 g/cm3) that has a mass of 0.65 kg?
1. 1 answer
2. 395 views
What is the volume of a piece of iron (ñ = 4.4 g/cm3) that has a mass of 0.65 kg?
1. 1 answer
2. 414 views
Write net ionic equation for the reaction between nitric acid and calcium hydroxide.
1. 2 answers
2. 717 views
A Solute That Removes Hydrogen Ions from Solution
1. 1 answer
2. 347 views
sam said if he ate half of a pie and ava ate a fourth of the pie then three-fourths of the pie will have been eaten
1. 1 answer
2. 462 views
what property of multiplication is used in the equation below? why?2 (3) 2 - (-)= - 7 3 7
1. 2 answers
2. 574 views
Crude oil pumped out of the ground may be accompanied by the formation of water, a solution that contains high concentrations of
1. 4 answers
2. 3,239 views
True/False1. Rosenstand argues that moral subjectivism is an intuitively sound, "live and let live" kind of moral position that
1. 3 answers
2. 783 views
True/False1. Rosenstand argues that moral subjectivism is an intuitively sound, "live and let live" kind of moral position that
1. 4 answers
2. 1,056 views
Can someone please check my answers if it is right. Thank you!True/False 1. Rosenstand argues that moral subjectivism is an
1. 2 answers
2. 759 views
At the fair, not only can I eat tasty food, but I can also see awesome fireworks. need help making sure its a parallel structure
1. 2 answers
2. 795 views
y=2/5x+c, determine the value of c if the line passes through the point P(-2,-4).answer: c=-16/5 ?
1. 1 answer
2. 364 views
Prove that 2sin150*cos315*cos(90-x)/sin(360-x)cos(-240)sin135
1. 1 answer
2. 398 views
A student has a mean score of five tests taken. What score must she obtain on her next test to have a mean average of 88 on all
1. 2 answers
2. 532 views
uncle tom cabinWhat specific event precipitated the writing of Uncle Tom s Cabin? Find the information in a documented source
1. 2 answers
2. 736 views
uncle tome cabinGradually and imperceptible the strange, silent, patient man, who was ready to bear everyone else's burden, and
1. 2 answers
2. 753 views
Log√35 - log√7 + log√2
1. 7 answers
2. 3,730 views
what is the rate of change for the following ordered pairs: (4,3) and (4,-2)
1. 1 answer
2. 250 views
what is the rate of change for these ordered pairs: (-1,4) (2, -7)im really bad with these
1. 5 answers
2. 395 views
when ur given ordered pairs, how do you determine if the relations is a function
1. 4 answers
2. 445 views

Questions LLC

Use AI to answer your questions.

Ask a New Question

Company

About Us
Careers
Contact Us
Privacy Policy
Terms of Use

Questions

Archives
Categories
Newest
Random
Search

Trending

Now
Today
Week
Month
Year

Social

Facebook
Instagram
LinkedIn
YouTube
X

© 2024 Questions LLC. All rights reserved.